C14H19NO — CID 144936344
ethane;3-methyl-2-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine (PubChem CID 144936344) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is ethane;3-methyl-2-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine.
| Compound Name | ethane;3-methyl-2-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine |
|---|---|
| PubChem CID | 144936344 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | ethane;3-methyl-2-[(Z)-prop-1-enyl]-4H-1,4-benzoxazine |
| SMILES | C/C=C\C1=C(C)Nc2ccccc2O1.CC |
| InChI | InChI=1S/C12H13NO.C2H6/c1-3-6-11-9(2)13-10-7-4-5-8-12(10)14-11;1-2/h3-8,13H,1-2H3;1-2H3/b6-3-; |
| InChIKey | IJVMVFVNZASDNH-AQPBACSKSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |