C16H13NO2 — CID 10729421
(2E)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one (PubChem CID 10729421) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is (2E)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one.
| Compound Name | (2E)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10729421 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (2E)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(/C=C2/Oc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C16H13NO2/c1-11-6-8-12(9-7-11)10-15-16(18)17-13-4-2-3-5-14(13)19-15/h2-10H,1H3,(H,17,18)/b15-10+ |
| InChIKey | WOGOXKYRQQOFSH-XNTDXEJSSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|