C14H14N2 — CID 142104011
5-[(1E)-buta-1,3-dienyl]-2-methylidene-1,3-dihydro-1,4-benzodiazepine (PubChem CID 142104011) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-[(1E)-buta-1,3-dienyl]-2-methylidene-1,3-dihydro-1,4-benzodiazepine.
| Compound Name | 5-[(1E)-buta-1,3-dienyl]-2-methylidene-1,3-dihydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 142104011 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5-[(1E)-buta-1,3-dienyl]-2-methylidene-1,3-dihydro-1,4-benzodiazepine |
| SMILES | C=C/C=C/C1=NCC(=C)Nc2ccccc21 |
| InChI | InChI=1S/C14H14N2/c1-3-4-8-13-12-7-5-6-9-14(12)16-11(2)10-15-13/h3-9,16H,1-2,10H2/b8-4+ |
| InChIKey | HQPJYSRLGLMGRU-XBXARRHUSA-N |
| XLogP | 3.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|