C18H30Se — CID 145022161
2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydroselenepine;ethane;methane (PubChem CID 145022161) has the molecular formula C18H30Se and a molecular weight of 325.40 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydroselenepine;ethane;methane.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydroselenepine;ethane;methane |
|---|---|
| PubChem CID | 145022161 |
| Molecular Formula | C18H30Se |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-6-[(Z)-prop-1-enyl]-4,5-dihydroselenepine;ethane;methane |
| SMILES | C.C=C/C=C\C1=C(C)CCC(/C=C\C)=C(C)[Se]1.CC |
| InChI | InChI=1S/C15H20Se.C2H6.CH4/c1-5-7-9-15-12(3)10-11-14(8-6-2)13(4)16-15;1-2;/h5-9H,1,10-11H2,2-4H3;1-2H3;1H4/b8-6-,9-7-;; |
| InChIKey | FRUMRBLGWCWIJW-SGBPTPMJSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|