C12H18 — CID 144706581
1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylcyclohexene (PubChem CID 144706581) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylcyclohexene.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 144706581 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylcyclohexene |
| SMILES | C=C/C=C\C1=C(C)C(C)CCC1 |
| InChI | InChI=1S/C12H18/c1-4-5-8-12-9-6-7-10(2)11(12)3/h4-5,8,10H,1,6-7,9H2,2-3H3/b8-5- |
| InChIKey | HGPXXYPZYRFZDG-YVMONPNESA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|