C29H41Br — CID 176958286
(5E,6E)-5-(1-bromoprop-2-enylidene)-6-hexan-3-ylidenecyclohexa-1,3-diene;1-[(1Z,3E)-hexa-1,3-dienyl]-2,3-dimethylcyclohexene (PubChem CID 176958286) has the molecular formula C29H41Br and a molecular weight of 469.55 g/mol. Its IUPAC name is (5E,6E)-5-(1-bromoprop-2-enylidene)-6-hexan-3-ylidenecyclohexa-1,3-diene;1-[(1Z,3E)-hexa-1,3-dienyl]-2,3-dimethylcyclohexene.
| Compound Name | (5E,6E)-5-(1-bromoprop-2-enylidene)-6-hexan-3-ylidenecyclohexa-1,3-diene;1-[(1Z,3E)-hexa-1,3-dienyl]-2,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 176958286 |
| Molecular Formula | C29H41Br |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (5E,6E)-5-(1-bromoprop-2-enylidene)-6-hexan-3-ylidenecyclohexa-1,3-diene;1-[(1Z,3E)-hexa-1,3-dienyl]-2,3-dimethylcyclohexene |
| SMILES | C=C/C(Br)=c1/cccc/c1=C(/CC)CCC.CC/C=C/C=C\C1=C(C)C(C)CCC1 |
| InChI | InChI=1S/C15H19Br.C14H22/c1-4-9-12(5-2)13-10-7-8-11-14(13)15(16)6-3;1-4-5-6-7-10-14-11-8-9-12(2)13(14)3/h6-8,10-11H,3-5,9H2,1-2H3;5-7,10,12H,4,8-9,11H2,1-3H3/b13-12+,15-14+;6-5+,10-7- |
| InChIKey | KNKKXIKFYLNYGI-YMYPORLGSA-N |
| XLogP | 8.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|