C22H32N2 — CID 142142135
1-benzyl-6-[(Z,2E)-2-ethylidenehex-3-enyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 142142135) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-benzyl-6-[(Z,2E)-2-ethylidenehex-3-enyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | 1-benzyl-6-[(Z,2E)-2-ethylidenehex-3-enyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 142142135 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-benzyl-6-[(Z,2E)-2-ethylidenehex-3-enyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | C/C=C(\C=C/CC)CN1CC2CCCN(Cc3ccccc3)C2C1 |
| InChI | InChI=1S/C22H32N2/c1-3-5-10-19(4-2)15-23-17-21-13-9-14-24(22(21)18-23)16-20-11-7-6-8-12-20/h4-8,10-12,21-22H,3,9,13-18H2,1-2H3/b10-5-,19-4+ |
| InChIKey | ZTWWYOPIRUAOHJ-KFLRBXAUSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|