C18H20 — CID 143323284
3-[(1Z)-buta-1,3-dienyl]-2-methyltricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene (PubChem CID 143323284) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-methyltricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyltricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene |
|---|---|
| PubChem CID | 143323284 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyltricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene |
| SMILES | C=C/C=C\C1=C(C)C2CCCCc3cccc1c32 |
| InChI | InChI=1S/C18H20/c1-3-4-10-15-13(2)16-11-6-5-8-14-9-7-12-17(15)18(14)16/h3-4,7,9-10,12,16H,1,5-6,8,11H2,2H3/b10-4- |
| InChIKey | GBKSAQGSZVIGJY-WMZJFQQLSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|