C20H16 — CID 615141
1,2,3,12b-tetrahydrobenzo[k]fluoranthene (PubChem CID 615141) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1,2,3,12b-tetrahydrobenzo[k]fluoranthene.
| Compound Name | 1,2,3,12b-tetrahydrobenzo[k]fluoranthene |
|---|---|
| PubChem CID | 615141 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1,2,3,12b-tetrahydrobenzo[k]fluoranthene |
| SMILES | c1cc2c3c(c1)-c1cc4ccccc4cc1C3CCC2 |
| InChI | InChI=1S/C20H16/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-3,5-7,9,11-12,17H,4,8,10H2 |
| InChIKey | YHNFGVBRQDPVRE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |