C16H12O — CID 176639548
2,10b-dihydro-1H-aceanthrylen-6-one (PubChem CID 176639548) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is 2,10b-dihydro-1H-aceanthrylen-6-one.
| Compound Name | 2,10b-dihydro-1H-aceanthrylen-6-one |
|---|---|
| PubChem CID | 176639548 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2,10b-dihydro-1H-aceanthrylen-6-one |
| SMILES | O=C1c2ccccc2C2CCc3cccc1c32 |
| InChI | InChI=1S/C16H12O/c17-16-13-6-2-1-5-11(13)12-9-8-10-4-3-7-14(16)15(10)12/h1-7,12H,8-9H2 |
| InChIKey | MXXKEVJRWPYEIC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |