C16H13FO — CID 125478212
(2S)-2-(2-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 125478212) has the molecular formula C16H13FO and a molecular weight of 240.28 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (2S)-2-(2-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 125478212 |
| Molecular Formula | C16H13FO |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2S)-2-(2-fluorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CC[C@H]1c1ccccc1F |
| InChI | InChI=1S/C16H13FO/c17-15-8-4-3-7-13(15)14-10-9-11-5-1-2-6-12(11)16(14)18/h1-8,14H,9-10H2/t14-/m0/s1 |
| InChIKey | AIGSSKZCIBLOAS-AWEZNQCLSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |