C15H11FO2 — CID 124528047
(3R)-3-(2-fluorophenyl)-2,3-dihydrochromen-4-one (PubChem CID 124528047) has the molecular formula C15H11FO2 and a molecular weight of 242.25 g/mol. Its IUPAC name is (3R)-3-(2-fluorophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (3R)-3-(2-fluorophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 124528047 |
| Molecular Formula | C15H11FO2 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (3R)-3-(2-fluorophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2ccccc2OC[C@H]1c1ccccc1F |
| InChI | InChI=1S/C15H11FO2/c16-13-7-3-1-5-10(13)12-9-18-14-8-4-2-6-11(14)15(12)17/h1-8,12H,9H2/t12-/m0/s1 |
| InChIKey | ZVXULMMMODCQQI-LBPRGKRZSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |