C11H11FO2 — CID 121220239
3-(2-fluorophenyl)oxan-2-one (PubChem CID 121220239) has the molecular formula C11H11FO2 and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-(2-fluorophenyl)oxan-2-one.
| Compound Name | 3-(2-fluorophenyl)oxan-2-one |
|---|---|
| PubChem CID | 121220239 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 3-(2-fluorophenyl)oxan-2-one |
| SMILES | O=C1OCCCC1c1ccccc1F |
| InChI | InChI=1S/C11H11FO2/c12-10-6-2-1-4-8(10)9-5-3-7-14-11(9)13/h1-2,4,6,9H,3,5,7H2 |
| InChIKey | UDSCAHICKRBFEQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |