C15H13FO — CID 173126795
2-(2,3-dihydro-1H-inden-1-yl)-6-fluorophenol (PubChem CID 173126795) has the molecular formula C15H13FO and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-yl)-6-fluorophenol.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-yl)-6-fluorophenol |
|---|---|
| PubChem CID | 173126795 |
| Molecular Formula | C15H13FO |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-yl)-6-fluorophenol |
| SMILES | Oc1c(F)cccc1C1CCc2ccccc21 |
| InChI | InChI=1S/C15H13FO/c16-14-7-3-6-13(15(14)17)12-9-8-10-4-1-2-5-11(10)12/h1-7,12,17H,8-9H2 |
| InChIKey | GZYGLMJHOWMAHD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |