C11H10O2 — CID 98051177
(2R)-1-oxo-3,4-dihydro-2H-naphthalene-2-carbaldehyde (PubChem CID 98051177) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2R)-1-oxo-3,4-dihydro-2H-naphthalene-2-carbaldehyde.
| Compound Name | (2R)-1-oxo-3,4-dihydro-2H-naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 98051177 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (2R)-1-oxo-3,4-dihydro-2H-naphthalene-2-carbaldehyde |
| SMILES | O=C[C@H]1CCc2ccccc2C1=O |
| InChI | InChI=1S/C11H10O2/c12-7-9-6-5-8-3-1-2-4-10(8)11(9)13/h1-4,7,9H,5-6H2/t9-/m1/s1 |
| InChIKey | UGOXYXBNKXBHAB-SECBINFHSA-N |
| XLogP | 1.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|