C17H13O2- — CID 19738613
1,2,3,10b-tetrahydrofluoranthene-1-carboxylate (PubChem CID 19738613) has the molecular formula C17H13O2- and a molecular weight of 249.29 g/mol. Its IUPAC name is 1,2,3,10b-tetrahydrofluoranthene-1-carboxylate.
| Compound Name | 1,2,3,10b-tetrahydrofluoranthene-1-carboxylate |
|---|---|
| PubChem CID | 19738613 |
| Molecular Formula | C17H13O2- |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1,2,3,10b-tetrahydrofluoranthene-1-carboxylate |
| SMILES | O=C([O-])C1CCc2cccc3c2C1c1ccccc1-3 |
| InChI | InChI=1S/C17H14O2/c18-17(19)14-9-8-10-4-3-7-12-11-5-1-2-6-13(11)16(14)15(10)12/h1-7,14,16H,8-9H2,(H,18,19)/p-1 |
| InChIKey | RJIPQKDZDJRYGY-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |