C13H10NO5- — CID 6953894
(2R)-5-oxo-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidine-2-carboxylate (PubChem CID 6953894) has the molecular formula C13H10NO5- and a molecular weight of 260.22 g/mol. Its IUPAC name is (2R)-5-oxo-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidine-2-carboxylate.
| Compound Name | (2R)-5-oxo-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6953894 |
| Molecular Formula | C13H10NO5- |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (2R)-5-oxo-1-[(1S)-3-oxo-1H-2-benzofuran-1-yl]pyrrolidine-2-carboxylate |
| SMILES | O=C1O[C@H](N2C(=O)CC[C@@H]2C(=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C13H11NO5/c15-10-6-5-9(12(16)17)14(10)11-7-3-1-2-4-8(7)13(18)19-11/h1-4,9,11H,5-6H2,(H,16,17)/p-1/t9-,11+/m1/s1 |
| InChIKey | BBYDVCBRFNLCJZ-KOLCDFICSA-M |
| XLogP | -0.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |