C19H15FN2O4 — CID 3736228
N-(2-fluorophenyl)-5-oxo-1-(3-oxo-1H-2-benzofuran-1-yl)pyrrolidine-2-carboxamide (PubChem CID 3736228) has the molecular formula C19H15FN2O4 and a molecular weight of 354.34 g/mol. Its IUPAC name is N-(2-fluorophenyl)-5-oxo-1-(3-oxo-1H-2-benzofuran-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-fluorophenyl)-5-oxo-1-(3-oxo-1H-2-benzofuran-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3736228 |
| Molecular Formula | C19H15FN2O4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(2-fluorophenyl)-5-oxo-1-(3-oxo-1H-2-benzofuran-1-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C1OC(N2C(=O)CCC2C(=O)Nc2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C19H15FN2O4/c20-13-7-3-4-8-14(13)21-17(24)15-9-10-16(23)22(15)18-11-5-1-2-6-12(11)19(25)26-18/h1-8,15,18H,9-10H2,(H,21,24) |
| InChIKey | XVVGVHGLIKOMIP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |