C17H13NO3 — CID 99984661
(1R,3E,10bR)-3-hydroxyimino-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid (PubChem CID 99984661) has the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. Its IUPAC name is (1R,3E,10bR)-3-hydroxyimino-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid.
| Compound Name | (1R,3E,10bR)-3-hydroxyimino-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid |
|---|---|
| PubChem CID | 99984661 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (1R,3E,10bR)-3-hydroxyimino-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C/C(=N\O)c2cccc3c2[C@H]1c1ccccc1-3 |
| InChI | InChI=1S/C17H13NO3/c19-17(20)13-8-14(18-21)12-7-3-6-11-9-4-1-2-5-10(9)16(13)15(11)12/h1-7,13,16,21H,8H2,(H,19,20)/b18-14+/t13-,16+/m1/s1 |
| InChIKey | HFPSBKMBZPTHQD-OOLAMXLOSA-N |
| XLogP | 3.08 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|