C17H12O3 — CID 97033627
(1S,10bS)-3-oxo-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid (PubChem CID 97033627) has the molecular formula C17H12O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is (1S,10bS)-3-oxo-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid.
| Compound Name | (1S,10bS)-3-oxo-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid |
|---|---|
| PubChem CID | 97033627 |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (1S,10bS)-3-oxo-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid |
| SMILES | O=C1C[C@H](C(=O)O)[C@H]2c3ccccc3-c3cccc1c32 |
| InChI | InChI=1S/C17H12O3/c18-14-8-13(17(19)20)16-10-5-2-1-4-9(10)11-6-3-7-12(14)15(11)16/h1-7,13,16H,8H2,(H,19,20)/t13-,16+/m0/s1 |
| InChIKey | IQDITGYLNALZDR-XJKSGUPXSA-N |
| XLogP | 3.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |