C9H8O3S — CID 175208861
3-oxo-1,2-dihydroindene-1-sulfinic acid (PubChem CID 175208861) has the molecular formula C9H8O3S and a molecular weight of 196.23 g/mol. Its IUPAC name is 3-oxo-1,2-dihydroindene-1-sulfinic acid.
| Compound Name | 3-oxo-1,2-dihydroindene-1-sulfinic acid |
|---|---|
| PubChem CID | 175208861 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 3-oxo-1,2-dihydroindene-1-sulfinic acid |
| SMILES | O=C1CC(S(=O)O)c2ccccc21 |
| InChI | InChI=1S/C9H8O3S/c10-8-5-9(13(11)12)7-4-2-1-3-6(7)8/h1-4,9H,5H2,(H,11,12) |
| InChIKey | VSKGHDVTIJCCRS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|