C15H16O3 — CID 14909433
(3'aR,9'bS)-spiro[1,3-dioxolane-2,3'-2,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene]-5'-one (PubChem CID 14909433) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3'aR,9'bS)-spiro[1,3-dioxolane-2,3'-2,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene]-5'-one.
| Compound Name | (3'aR,9'bS)-spiro[1,3-dioxolane-2,3'-2,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene]-5'-one |
|---|---|
| PubChem CID | 14909433 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3'aR,9'bS)-spiro[1,3-dioxolane-2,3'-2,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene]-5'-one |
| SMILES | O=C1C[C@@H]2[C@H](CCC23OCCO3)c2ccccc21 |
| InChI | InChI=1S/C15H16O3/c16-14-9-13-11(10-3-1-2-4-12(10)14)5-6-15(13)17-7-8-18-15/h1-4,11,13H,5-9H2/t11-,13-/m1/s1 |
| InChIKey | KGGSWQNBONQSLV-DGCLKSJQSA-N |
| XLogP | 2.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |