C18H14O2 — CID 20693098
3-(2-oxo-1,3-dihydroinden-1-yl)-2,3-dihydroinden-1-one (PubChem CID 20693098) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(2-oxo-1,3-dihydroinden-1-yl)-2,3-dihydroinden-1-one.
| Compound Name | 3-(2-oxo-1,3-dihydroinden-1-yl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 20693098 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-(2-oxo-1,3-dihydroinden-1-yl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CC(C2C(=O)Cc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C18H14O2/c19-16-10-15(13-7-3-4-8-14(13)16)18-12-6-2-1-5-11(12)9-17(18)20/h1-8,15,18H,9-10H2 |
| InChIKey | JPJUOCHNNJWTLO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |