C12H8O3 — CID 102478924
2a,8b-dihydro-2H-cyclobuta[a]naphthalene-1,3,4-trione (PubChem CID 102478924) has the molecular formula C12H8O3 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2a,8b-dihydro-2H-cyclobuta[a]naphthalene-1,3,4-trione.
| Compound Name | 2a,8b-dihydro-2H-cyclobuta[a]naphthalene-1,3,4-trione |
|---|---|
| PubChem CID | 102478924 |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2a,8b-dihydro-2H-cyclobuta[a]naphthalene-1,3,4-trione |
| SMILES | O=C1C(=O)C2CC(=O)C2c2ccccc21 |
| InChI | InChI=1S/C12H8O3/c13-9-5-8-10(9)6-3-1-2-4-7(6)11(14)12(8)15/h1-4,8,10H,5H2 |
| InChIKey | STDHAIXGCGDMQL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|