C14H12O5 — CID 44888706
(1S,8R)-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dicarboxylic acid (PubChem CID 44888706) has the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. Its IUPAC name is (1S,8R)-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dicarboxylic acid.
| Compound Name | (1S,8R)-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dicarboxylic acid |
|---|---|
| PubChem CID | 44888706 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (1S,8R)-11-oxotricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dicarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)O)[C@H]2CC(=O)[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C14H12O5/c15-9-5-8-6-3-1-2-4-7(6)10(9)12(14(18)19)11(8)13(16)17/h1-4,8,10-12H,5H2,(H,16,17)(H,18,19)/t8-,10-,11?,12?/m0/s1 |
| InChIKey | AXEBGCZYVSAZRU-GIGLLKTKSA-N |
| XLogP | 1.24 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |