C11H10O — CID 130027584
tricyclo[5.4.0.02,6]undeca-1(11),7,9-trien-3-one (PubChem CID 130027584) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is tricyclo[5.4.0.02,6]undeca-1(11),7,9-trien-3-one.
| Compound Name | tricyclo[5.4.0.02,6]undeca-1(11),7,9-trien-3-one |
|---|---|
| PubChem CID | 130027584 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | tricyclo[5.4.0.02,6]undeca-1(11),7,9-trien-3-one |
| SMILES | O=C1CCC2c3ccccc3C12 |
| InChI | InChI=1S/C11H10O/c12-10-6-5-9-7-3-1-2-4-8(7)11(9)10/h1-4,9,11H,5-6H2 |
| InChIKey | QTUVHHGDNMATQH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |