C10H10 — CID 68882978
(5S)-tricyclo[4.4.0.02,5]deca-1(10),6,8-triene (PubChem CID 68882978) has the molecular formula C10H10 and a molecular weight of 130.19 g/mol. Its IUPAC name is (5S)-tricyclo[4.4.0.02,5]deca-1(10),6,8-triene.
| Compound Name | (5S)-tricyclo[4.4.0.02,5]deca-1(10),6,8-triene |
|---|---|
| PubChem CID | 68882978 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | (5S)-tricyclo[4.4.0.02,5]deca-1(10),6,8-triene |
| SMILES | c1ccc2c(c1)C1CC[C@H]21 |
| InChI | InChI=1S/C10H10/c1-2-4-8-7(3-1)9-5-6-10(8)9/h1-4,9-10H,5-6H2/t9-,10?/m1/s1 |
| InChIKey | RHZZHLHWYCRUIW-YHMJZVADSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |