C16H15Cl — CID 158531622
tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene;hydrochloride (PubChem CID 158531622) has the molecular formula C16H15Cl and a molecular weight of 242.75 g/mol. Its IUPAC name is tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene;hydrochloride.
| Compound Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene;hydrochloride |
|---|---|
| PubChem CID | 158531622 |
| Molecular Formula | C16H15Cl |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)C1CCC2c2ccccc21 |
| InChI | InChI=1S/C16H14.ClH/c1-2-6-12-11(5-1)15-9-10-16(12)14-8-4-3-7-13(14)15;/h1-8,15-16H,9-10H2;1H |
| InChIKey | HNLDLXIFIYYXTE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |