C16H16N2 — CID 18931735
tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,4-diamine (PubChem CID 18931735) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,4-diamine.
| Compound Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,4-diamine |
|---|---|
| PubChem CID | 18931735 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,4-diamine |
| SMILES | Nc1ccc2c(c1N)C1CCC2c2ccccc21 |
| InChI | InChI=1S/C16H16N2/c17-14-8-7-13-11-5-6-12(15(13)16(14)18)10-4-2-1-3-9(10)11/h1-4,7-8,11-12H,5-6,17-18H2 |
| InChIKey | GANXAVHSZSCWHZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|