About (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one
(1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one (PubChem CID 124539739) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one.
Analyze (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one?
The IUPAC name of (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one (CID 124539739) is (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one.
What is the SMILES notation for (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one?
The canonical SMILES for (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one is O=C1N[C@H]2CC[C@H]1c1ccccc12.
What is the InChIKey of (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one?
The InChIKey is BPBPNUGGTKXXAM-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H11NO/c13-11-9-5-6-10(12-11)8-4-2-1-3-7(8)9/h1-4,9-10H,5-6H2,(H,12,13)/t9-,10-/m0/s1.
What are the key properties of (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one?
(1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one has a molecular weight of 173.22 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8S)-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-10-one is sourced from PubChem (CID 124539739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).