C16H16O2 — CID 98557806
(1R,8R,10S,13R)-tetracyclo[6.6.1.110,13.02,7]hexadeca-2,4,6-triene-9,14-dione (PubChem CID 98557806) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1R,8R,10S,13R)-tetracyclo[6.6.1.110,13.02,7]hexadeca-2,4,6-triene-9,14-dione.
| Compound Name | (1R,8R,10S,13R)-tetracyclo[6.6.1.110,13.02,7]hexadeca-2,4,6-triene-9,14-dione |
|---|---|
| PubChem CID | 98557806 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (1R,8R,10S,13R)-tetracyclo[6.6.1.110,13.02,7]hexadeca-2,4,6-triene-9,14-dione |
| SMILES | O=C1[C@@H]2CC[C@@H](C2)C(=O)[C@@H]2C[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C16H16O2/c17-15-9-5-6-10(7-9)16(18)14-8-13(15)11-3-1-2-4-12(11)14/h1-4,9-10,13-14H,5-8H2/t9-,10+,13-,14-/m1/s1 |
| InChIKey | YRSJNRIOPYFJRB-RDBQEKCUSA-N |
| XLogP | 2.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |