C13H18 — CID 91342553
ethane;tricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 91342553) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is ethane;tricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | ethane;tricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 91342553 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | ethane;tricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC.c1ccc2c(c1)C1CCC2C1 |
| InChI | InChI=1S/C11H12.C2H6/c1-2-4-11-9-6-5-8(7-9)10(11)3-1;1-2/h1-4,8-9H,5-7H2;1-2H3 |
| InChIKey | ARSFHVSGXFHZIC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |