C12H14 — CID 135034885
(1S,9R)-tricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 135034885) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is (1S,9R)-tricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9R)-tricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 135034885 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (1S,9R)-tricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)C[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C12H14/c1-2-4-12-10(3-1)7-9-5-6-11(12)8-9/h1-4,9,11H,5-8H2/t9-,11-/m0/s1 |
| InChIKey | VFBAUHRKCQUDED-ONGXEEELSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |