C10H11N — CID 93492521
(2aR,7bS)-2,2a,3,7b-tetrahydro-1H-indeno[1,2-b]azete (PubChem CID 93492521) has the molecular formula C10H11N and a molecular weight of 145.21 g/mol. Its IUPAC name is (2aR,7bS)-2,2a,3,7b-tetrahydro-1H-indeno[1,2-b]azete.
| Compound Name | (2aR,7bS)-2,2a,3,7b-tetrahydro-1H-indeno[1,2-b]azete |
|---|---|
| PubChem CID | 93492521 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (2aR,7bS)-2,2a,3,7b-tetrahydro-1H-indeno[1,2-b]azete |
| SMILES | c1ccc2c(c1)C[C@@H]1CN[C@H]21 |
| InChI | InChI=1S/C10H11N/c1-2-4-9-7(3-1)5-8-6-11-10(8)9/h1-4,8,10-11H,5-6H2/t8-,10+/m1/s1 |
| InChIKey | SOMFMLLQFUJZLJ-SCZZXKLOSA-N |
| XLogP | 1.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |