About CID 59694666
CID 59694666 (PubChem CID 59694666) has the molecular formula C10H10NO
and a molecular weight of 160.20 g/mol.
Molecular Properties
| Compound Name | CID 59694666 |
| PubChem CID | 59694666 |
| Molecular Formula | C10H10NO |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | — |
| SMILES | [CH]1N[C@H]2c3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C10H10NO/c1-2-4-8-7(3-1)5-9-10(8)11-6-12-9/h1-4,6,9-11H,5H2/t9-,10+/m1/s1 |
| InChIKey | ZIGMRPOHRWQVJZ-ZJUUUORDSA-N |
| XLogP | 1.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59694666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59694666?
The IUPAC name of CID 59694666 (CID 59694666) is not available.
What is the SMILES notation for CID 59694666?
The canonical SMILES for CID 59694666 is [CH]1N[C@H]2c3ccccc3C[C@H]2O1.
What is the InChIKey of CID 59694666?
The InChIKey is ZIGMRPOHRWQVJZ-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H10NO/c1-2-4-8-7(3-1)5-9-10(8)11-6-12-9/h1-4,6,9-11H,5H2/t9-,10+/m1/s1.
What are the key properties of CID 59694666?
CID 59694666 has a molecular weight of 160.20 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59694666 is sourced from PubChem (CID 59694666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).