C10H10NO — CID 59694666
CID 59694666 (PubChem CID 59694666) has the molecular formula C10H10NO and a molecular weight of 160.20 g/mol.
| Compound Name | CID 59694666 |
|---|---|
| PubChem CID | 59694666 |
| Molecular Formula | C10H10NO |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | — |
| SMILES | [CH]1N[C@H]2c3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C10H10NO/c1-2-4-8-7(3-1)5-9-10(8)11-6-12-9/h1-4,6,9-11H,5H2/t9-,10+/m1/s1 |
| InChIKey | ZIGMRPOHRWQVJZ-ZJUUUORDSA-N |
| XLogP | 1.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |