C10H9NOS — CID 147368234
(3aR,8bS)-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole-2-thione (PubChem CID 147368234) has the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. Its IUPAC name is (3aR,8bS)-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole-2-thione.
| Compound Name | (3aR,8bS)-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole-2-thione |
|---|---|
| PubChem CID | 147368234 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | (3aR,8bS)-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole-2-thione |
| SMILES | S=C1N[C@H]2c3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C10H9NOS/c13-10-11-9-7-4-2-1-3-6(7)5-8(9)12-10/h1-4,8-9H,5H2,(H,11,13)/t8-,9+/m1/s1 |
| InChIKey | DIOZSJXTBQCNTG-BDAKNGLRSA-N |
| XLogP | 1.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|