C10H12B2LiNO — CID 23662091
CID 23662091 (PubChem CID 23662091) has the molecular formula C10H12B2LiNO and a molecular weight of 190.78 g/mol.
| Compound Name | CID 23662091 |
|---|---|
| PubChem CID | 23662091 |
| Molecular Formula | C10H12B2LiNO |
| Molecular Weight | 190.78 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | — |
| SMILES | CB1NC2c3ccccc3CC2O1.[B-].[Li+] |
| InChI | InChI=1S/C10H12BNO.B.Li/c1-11-12-10-8-5-3-2-4-7(8)6-9(10)13-11;;/h2-5,9-10,12H,6H2,1H3;;/q;-1;+1 |
| InChIKey | LCGHTZCPKYGPMU-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.78 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|