C10H12BNO — CID 11355770
(3aR,8bS)-2-methyl-3,3a,4,8b-tetrahydroindeno[2,1-d][1,3,2]oxazaborole (PubChem CID 11355770) has the molecular formula C10H12BNO and a molecular weight of 173.02 g/mol. Its IUPAC name is (3aR,8bS)-2-methyl-3,3a,4,8b-tetrahydroindeno[2,1-d][1,3,2]oxazaborole.
| Compound Name | (3aR,8bS)-2-methyl-3,3a,4,8b-tetrahydroindeno[2,1-d][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 11355770 |
| Molecular Formula | C10H12BNO |
| Molecular Weight | 173.02 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (3aR,8bS)-2-methyl-3,3a,4,8b-tetrahydroindeno[2,1-d][1,3,2]oxazaborole |
| SMILES | CB1N[C@@H]2Cc3ccccc3[C@@H]2O1 |
| InChI | InChI=1S/C10H12BNO/c1-11-12-9-6-7-4-2-3-5-8(7)10(9)13-11/h2-5,9-10,12H,6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | XGSGIJOWPFIEHH-ZJUUUORDSA-N |
| XLogP | 1.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.02 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|