C13H17NO — CID 43174689
3-ethyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazine (PubChem CID 43174689) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-ethyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazine.
| Compound Name | 3-ethyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 43174689 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-ethyl-2,3,4,4a,5,9b-hexahydroindeno[1,2-b][1,4]oxazine |
| SMILES | CCC1COC2c3ccccc3CC2N1 |
| InChI | InChI=1S/C13H17NO/c1-2-10-8-15-13-11-6-4-3-5-9(11)7-12(13)14-10/h3-6,10,12-14H,2,7-8H2,1H3 |
| InChIKey | HTDMZKLXGTVZOZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |