C13H19NO2 — CID 57311823
1,3-diethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 57311823) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1,3-diethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1,3-diethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 57311823 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1,3-diethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCOC1Cc2ccccc2C(OCC)N1 |
| InChI | InChI=1S/C13H19NO2/c1-3-15-12-9-10-7-5-6-8-11(10)13(14-12)16-4-2/h5-8,12-14H,3-4,9H2,1-2H3 |
| InChIKey | JDTZHHKWWPDVRT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |