C23H30B2N2O2 — CID 158963489
(3aS,8bR)-2-butyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole;(3aS,8bR)-2-methyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole (PubChem CID 158963489) has the molecular formula C23H30B2N2O2 and a molecular weight of 388.13 g/mol. Its IUPAC name is (3aS,8bR)-2-butyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole;(3aS,8bR)-2-methyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole.
| Compound Name | (3aS,8bR)-2-butyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole;(3aS,8bR)-2-methyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 158963489 |
| Molecular Formula | C23H30B2N2O2 |
| Molecular Weight | 388.13 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (3aS,8bR)-2-butyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole;(3aS,8bR)-2-methyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3,2]oxazaborole |
| SMILES | CB1N[C@@H]2c3ccccc3C[C@@H]2O1.CCCCB1N[C@@H]2c3ccccc3C[C@@H]2O1 |
| InChI | InChI=1S/C13H18BNO.C10H12BNO/c1-2-3-8-14-15-13-11-7-5-4-6-10(11)9-12(13)16-14;1-11-12-10-8-5-3-2-4-7(8)6-9(10)13-11/h4-7,12-13,15H,2-3,8-9H2,1H3;2-5,9-10,12H,6H2,1H3/t12-,13+;9-,10+/m00/s1 |
| InChIKey | JMXIDXRJJLKYBU-TYWHLNLWSA-N |
| XLogP | 3.95 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.13 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|