C17H26O — CID 90912127
1,3-dibutyl-3,4-dihydro-1H-isochromene (PubChem CID 90912127) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1,3-dibutyl-3,4-dihydro-1H-isochromene.
| Compound Name | 1,3-dibutyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 90912127 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1,3-dibutyl-3,4-dihydro-1H-isochromene |
| SMILES | CCCCC1Cc2ccccc2C(CCCC)O1 |
| InChI | InChI=1S/C17H26O/c1-3-5-10-15-13-14-9-7-8-11-16(14)17(18-15)12-6-4-2/h7-9,11,15,17H,3-6,10,12-13H2,1-2H3 |
| InChIKey | KILNEOIXKDYBTA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |