C14H19BO2 — CID 6427281
(3aR,9aR)-2-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole (PubChem CID 6427281) has the molecular formula C14H19BO2 and a molecular weight of 230.12 g/mol. Its IUPAC name is (3aR,9aR)-2-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole.
| Compound Name | (3aR,9aR)-2-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole |
|---|---|
| PubChem CID | 6427281 |
| Molecular Formula | C14H19BO2 |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (3aR,9aR)-2-butyl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole |
| SMILES | CCCCB1O[C@@H]2Cc3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C14H19BO2/c1-2-3-8-15-16-13-9-11-6-4-5-7-12(11)10-14(13)17-15/h4-7,13-14H,2-3,8-10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | BJHRXOCAFPZFSY-ZIAGYGMSSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|