C12H15NO — CID 89389775
(3aR,8bS)-2,2-dimethyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole (PubChem CID 89389775) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (3aR,8bS)-2,2-dimethyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole.
| Compound Name | (3aR,8bS)-2,2-dimethyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 89389775 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3aR,8bS)-2,2-dimethyl-1,3a,4,8b-tetrahydroindeno[1,2-d][1,3]oxazole |
| SMILES | CC1(C)N[C@H]2c3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C12H15NO/c1-12(2)13-11-9-6-4-3-5-8(9)7-10(11)14-12/h3-6,10-11,13H,7H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | MZDSQNBIXPRLQJ-MNOVXSKESA-N |
| XLogP | 2.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |