C12H15NS — CID 66218911
3-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine (PubChem CID 66218911) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 3-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine.
| Compound Name | 3-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine |
|---|---|
| PubChem CID | 66218911 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine |
| SMILES | CC1CSC2Cc3ccccc3C2N1 |
| InChI | InChI=1S/C12H15NS/c1-8-7-14-11-6-9-4-2-3-5-10(9)12(11)13-8/h2-5,8,11-13H,6-7H2,1H3 |
| InChIKey | QXHJIMUDXXVMAI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |