C13H17NOS — CID 66218175
2-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide (PubChem CID 66218175) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide.
| Compound Name | 2-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide |
|---|---|
| PubChem CID | 66218175 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-methyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide |
| SMILES | CC1CS(=O)C2CCc3ccccc3C2N1 |
| InChI | InChI=1S/C13H17NOS/c1-9-8-16(15)12-7-6-10-4-2-3-5-11(10)13(12)14-9/h2-5,9,12-14H,6-8H2,1H3 |
| InChIKey | PWQPWCZOFIZFLZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |