C14H19NOS — CID 66229834
2-ethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide (PubChem CID 66229834) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-ethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide.
| Compound Name | 2-ethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide |
|---|---|
| PubChem CID | 66229834 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-ethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f][1,4]benzothiazine 4-oxide |
| SMILES | CCC1CS(=O)C2CCc3ccccc3C2N1 |
| InChI | InChI=1S/C14H19NOS/c1-2-11-9-17(16)13-8-7-10-5-3-4-6-12(10)14(13)15-11/h3-6,11,13-15H,2,7-9H2,1H3 |
| InChIKey | PQJGJCGUKGXBQV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |