C12H15Br — CID 63514780
5-bromo-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 63514780) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 5-bromo-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-bromo-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 63514780 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-bromo-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CC1CCc2ccccc2C(Br)C1 |
| InChI | InChI=1S/C12H15Br/c1-9-6-7-10-4-2-3-5-11(10)12(13)8-9/h2-5,9,12H,6-8H2,1H3 |
| InChIKey | JIOZTAYGAFNJQZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|