About 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene
11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 59079694) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
Analyze 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
The IUPAC name of 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene (CID 59079694) is 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
What is the SMILES notation for 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
The canonical SMILES for 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene is CCN1CC2Cc3ccccc3C(C2)C1.
What is the InChIKey of 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
The InChIKey is AEYXWGCEFGWIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-2-15-9-11-7-12-5-3-4-6-14(12)13(8-11)10-15/h3-6,11,13H,2,7-10H2,1H3.
What are the key properties of 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene has a molecular weight of 201.31 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-ethyl-11-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene is sourced from PubChem (CID 59079694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).