C11H13N — CID 131028254
(1S,8R)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-3-amine (PubChem CID 131028254) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is (1S,8R)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-3-amine.
| Compound Name | (1S,8R)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-3-amine |
|---|---|
| PubChem CID | 131028254 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (1S,8R)-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-3-amine |
| SMILES | Nc1cccc2c1[C@H]1CC[C@@H]2C1 |
| InChI | InChI=1S/C11H13N/c12-10-3-1-2-9-7-4-5-8(6-7)11(9)10/h1-3,7-8H,4-6,12H2/t7-,8+/m1/s1 |
| InChIKey | BKQHSLRUFYATMH-SFYZADRCSA-N |
| XLogP | 2.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|